Products 379670-16-3
CAS 379670-16-3 is the registry number for (2R,3R)-2-Amino-3-(tert-butoxy)butan-1-ol, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2R,3R)-2-amino-3-[(2-methylpropan-2-yl)oxy]butan-1-ol (CAS 379670-16-3) is a chemical compound with the molecular formula C8H19NO2 and a molecular weight of 161.24 g/mol. IUPAC name: (2R,3R)-2-amino-3-[(2-methylpropan-2-yl)oxy]butan-1-ol. InChIKey: ONGCTAZPASBBSH-RNFRBKRXSA-N.
| Molecular formula | C8H19NO2 |
|---|---|
| Molecular weight | 161.24 g/mol |
| IUPAC name | (2R,3R)-2-amino-3-[(2-methylpropan-2-yl)oxy]butan-1-ol |
| InChIKey | ONGCTAZPASBBSH-RNFRBKRXSA-N |
| SMILES | C[C@H]([C@@H](CO)N)OC(C)(C)C |
Computed by PubChem (NCBI)