CAS 379711-35-0 appears in our catalog under these names: 2,5-Dibromoisophthalic acid, 95%, 2,5-Dibromoisophthalic acid, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 25g, 100mg, 250mg, 1g, 5g.
2,5-dibromobenzene-1,3-dicarboxylic acid (CAS 379711-35-0) is a chemical compound with the molecular formula C8H4Br2O4 and a molecular weight of 323.92 g/mol. IUPAC name: 2,5-dibromobenzene-1,3-dicarboxylic acid. InChIKey: MCBAPDGFMNMXOL-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2O4 |
|---|---|
| Molecular weight | 323.92 g/mol |
| IUPAC name | 2,5-dibromobenzene-1,3-dicarboxylic acid |
| InChIKey | MCBAPDGFMNMXOL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)Br)C(=O)O)Br |
Computed by PubChem (NCBI)