Products 379712-59-1
CAS 379712-59-1 appears in our catalog under these names: Phosphatidylcholine transfer protein inhibitor–2, Phosphatidylcholine transfer protein inhibitor-2, ≥98%, ≥98%, Phosphatidylcholine transfer protein inhibitor-2, 98.14%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1mg, 25mg, 50mg, 100mg, 250mg, 5 mg.
N-[[2-chloro-5-[(3-chlorophenyl)sulfamoyl]phenyl]carbamothioyl]-4-fluorobenzamide (CAS 379712-59-1) is a chemical compound with the molecular formula C20H14Cl2FN3O3S2 and a molecular weight of 498.4 g/mol. IUPAC name: N-[[2-chloro-5-[(3-chlorophenyl)sulfamoyl]phenyl]carbamothioyl]-4-fluorobenzamide. InChIKey: PLUIJIKIACMFSD-UHFFFAOYSA-N.
| Molecular formula | C20H14Cl2FN3O3S2 |
|---|---|
| Molecular weight | 498.4 g/mol |
| IUPAC name | N-[[2-chloro-5-[(3-chlorophenyl)sulfamoyl]phenyl]carbamothioyl]-4-fluorobenzamide |
| InChIKey | PLUIJIKIACMFSD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)NS(=O)(=O)C2=CC(=C(C=C2)Cl)NC(=S)NC(=O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)