CAS 379728-15-1 is the registry number for 3-(Thiophen-2-ylmethylidene)-1H,2H,3H-cyclopenta(b)quinoline-9-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
(3Z)-3-(thiophen-2-ylmethylidene)-1,2-dihydrocyclopenta[b]quinoline-9-carboxylic acid (CAS 379728-15-1) is a chemical compound with the molecular formula C18H13NO2S and a molecular weight of 307.4 g/mol. IUPAC name: (3Z)-3-(thiophen-2-ylmethylidene)-1,2-dihydrocyclopenta[b]quinoline-9-carboxylic acid. InChIKey: WTCZJNWYQUOWKW-KHPPLWFESA-N.
| Molecular formula | C18H13NO2S |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | (3Z)-3-(thiophen-2-ylmethylidene)-1,2-dihydrocyclopenta[b]quinoline-9-carboxylic acid |
| InChIKey | WTCZJNWYQUOWKW-KHPPLWFESA-N |
| SMILES | C\1CC2=C(C3=CC=CC=C3N=C2/C1=C\C4=CC=CS4)C(=O)O |
Computed by PubChem (NCBI)