CAS 380-63-2 is the registry number for 1,1,1-Trichloro-2,2,4,4,4-pentafluorobutane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,1,1-trichloro-2,2,4,4,4-pentafluorobutane (CAS 380-63-2) is a chemical compound with the molecular formula C4H2Cl3F5 and a molecular weight of 251.40 g/mol. IUPAC name: 1,1,1-trichloro-2,2,4,4,4-pentafluorobutane. InChIKey: PBTBFYFONKOINH-UHFFFAOYSA-N.
| Molecular formula | C4H2Cl3F5 |
|---|---|
| Molecular weight | 251.40 g/mol |
| IUPAC name | 1,1,1-trichloro-2,2,4,4,4-pentafluorobutane |
| InChIKey | PBTBFYFONKOINH-UHFFFAOYSA-N |
| SMILES | C(C(C(Cl)(Cl)Cl)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)