CAS 38006-08-5 appears in our catalog under these names: Sulfamonomethoxine sodium, Sulfamonomethoxine Sodium, >95% (HPLC), Sulfamonomethoxine sodium 97%, Sulfamonomethoxine sodium, 98%, 98%, Sulfamonomethoxine (sodium), 99.88%. Offered by: Dr. Ehrenstorfer, TRC, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 5g, 25g, 100g, 10g, 1g.
Sodium (4-aminophenyl)sulfonyl-(6-methoxypyrimidin-4-yl)azanide (CAS 38006-08-5) is a chemical compound with the molecular formula C11H11N4NaO3S and a molecular weight of 302.29 g/mol. IUPAC name: sodium (4-aminophenyl)sulfonyl-(6-methoxypyrimidin-4-yl)azanide. InChIKey: IZJAOWYNDLDRKM-UHFFFAOYSA-N.
| Molecular formula | C11H11N4NaO3S |
|---|---|
| Molecular weight | 302.29 g/mol |
| IUPAC name | sodium (4-aminophenyl)sulfonyl-(6-methoxypyrimidin-4-yl)azanide |
| InChIKey | IZJAOWYNDLDRKM-UHFFFAOYSA-N |
| SMILES | COC1=NC=NC(=C1)[N-]S(=O)(=O)C2=CC=C(C=C2)N.[Na+] |
Computed by PubChem (NCBI)