CAS 380172-19-0 is the registry number for 1-((4,6-Dimethylpyrimidin-2-yl)thio)-3,3-dimethylbutan-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3,3-dimethylbutan-2-one (CAS 380172-19-0) is a chemical compound with the molecular formula C12H18N2OS and a molecular weight of 238.35 g/mol. IUPAC name: 1-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3,3-dimethylbutan-2-one. InChIKey: FNXVDJGGZAWCOJ-UHFFFAOYSA-N.
| Molecular formula | C12H18N2OS |
|---|---|
| Molecular weight | 238.35 g/mol |
| IUPAC name | 1-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3,3-dimethylbutan-2-one |
| InChIKey | FNXVDJGGZAWCOJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)SCC(=O)C(C)(C)C)C |
Computed by PubChem (NCBI)