CAS 380173-16-0 is the registry number for 2-(Benzylamino)-2-oxoethyl 2-(furan-2-yl)quinoline-4-carboxylate. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[2-(benzylamino)-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate (CAS 380173-16-0) is a chemical compound with the molecular formula C23H18N2O4 and a molecular weight of 386.4 g/mol. IUPAC name: [2-(benzylamino)-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate. InChIKey: PIPJWZGFHPLOMX-UHFFFAOYSA-N.
| Molecular formula | C23H18N2O4 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | [2-(benzylamino)-2-oxoethyl] 2-(furan-2-yl)quinoline-4-carboxylate |
| InChIKey | PIPJWZGFHPLOMX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)COC(=O)C2=CC(=NC3=CC=CC=C32)C4=CC=CO4 |
Computed by PubChem (NCBI)