CAS 38019-09-9 appears in our catalog under these names: Tris(3–bromophenyl)phosphine Oxide, Tris(3-bromophenyl)phosphine Oxide, >98.0%(GC), Tris(3-bromophenyl)phosphine Oxide 98%, Tris(3-bromophenyl)phosphine Oxide, 98%, 98%, TRIS(3-BROMOPHENYL)PHOSPHINE OXIDE, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 200mg, 1g, 100mg, 250mg, 5g.
1-bis(3-bromophenyl)phosphoryl-3-bromobenzene (CAS 38019-09-9) is a chemical compound with the molecular formula C18H12Br3OP and a molecular weight of 515.0 g/mol. IUPAC name: 1-bis(3-bromophenyl)phosphoryl-3-bromobenzene. InChIKey: SSUTVUULXWQIEW-UHFFFAOYSA-N.
| Molecular formula | C18H12Br3OP |
|---|---|
| Molecular weight | 515.0 g/mol |
| IUPAC name | 1-bis(3-bromophenyl)phosphoryl-3-bromobenzene |
| InChIKey | SSUTVUULXWQIEW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)P(=O)(C2=CC(=CC=C2)Br)C3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)