Products 380193-53-3

CAS 380193-53-3 is the registry number for 3-(4-(Difluoromethoxy)phenyl)-2-phenylprop-2-enoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-[4-(difluoromethoxy)phenyl]-2-phenylprop-2-enoic acid (CAS 380193-53-3) is a chemical compound with the molecular formula C16H12F2O3 and a molecular weight of 290.26 g/mol. IUPAC name: 3-[4-(difluoromethoxy)phenyl]-2-phenylprop-2-enoic acid. InChIKey: NWLRLIOHTHGLHV-UHFFFAOYSA-N.

Identity
Molecular formulaC16H12F2O3
Molecular weight290.26 g/mol
IUPAC name3-[4-(difluoromethoxy)phenyl]-2-phenylprop-2-enoic acid
InChIKeyNWLRLIOHTHGLHV-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(=CC2=CC=C(C=C2)OC(F)F)C(=O)O

Computed by PubChem (NCBI)