CAS 380193-99-7 appears in our catalog under these names: 5-[(4-Butylphenyl)sulfamoyl]-2,4-dichlorobenzoic acid, 95%, 5-((4-Butylphenyl)sulfamoyl)-2,4-dichlorobenzoic acid, 95%, 5-((4-Butylphenyl)sulfamoyl)-2,4-dichlorobenzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
5-[(4-butylphenyl)sulfamoyl]-2,4-dichlorobenzoic acid (CAS 380193-99-7) is a chemical compound with the molecular formula C17H17Cl2NO4S and a molecular weight of 402.3 g/mol. IUPAC name: 5-[(4-butylphenyl)sulfamoyl]-2,4-dichlorobenzoic acid. InChIKey: DQRIQAPZQQHYBE-UHFFFAOYSA-N.
| Molecular formula | C17H17Cl2NO4S |
|---|---|
| Molecular weight | 402.3 g/mol |
| IUPAC name | 5-[(4-butylphenyl)sulfamoyl]-2,4-dichlorobenzoic acid |
| InChIKey | DQRIQAPZQQHYBE-UHFFFAOYSA-N |
| SMILES | CCCCC1=CC=C(C=C1)NS(=O)(=O)C2=C(C=C(C(=C2)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)