CAS 380230-73-9 appears in our catalog under these names: 2,2,2-Trifluoroethyl triethylammonium triflate, 95%, 2,2,2-Trifluoroethyltriethylammoniumtriflate, 98%, N,N,N–triethyl–2,2,2–trifluoroethan–1–aminium trifluoromethanesulfonate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 25g, 1g.
Triethyl(2,2,2-trifluoroethyl)azanium;trifluoromethanesulfonate (CAS 380230-73-9) is a chemical compound with the molecular formula C9H17F6NO3S and a molecular weight of 333.29 g/mol. IUPAC name: triethyl(2,2,2-trifluoroethyl)azanium;trifluoromethanesulfonate. InChIKey: VDBVQAPVHZQGQS-UHFFFAOYSA-M.
| Molecular formula | C9H17F6NO3S |
|---|---|
| Molecular weight | 333.29 g/mol |
| IUPAC name | triethyl(2,2,2-trifluoroethyl)azanium;trifluoromethanesulfonate |
| InChIKey | VDBVQAPVHZQGQS-UHFFFAOYSA-M |
| SMILES | CC[N+](CC)(CC)CC(F)(F)F.C(F)(F)(F)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)