CAS 380305-63-5 appears in our catalog under these names: Potassium trifluoro(trifluoroethenyl)boranuide, 95%, Potassium trifluoro(trifluoroethenyl)boranuide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Potassium trifluoro(1,2,2-trifluoroethenyl)boranuide (CAS 380305-63-5) is a chemical compound with the molecular formula C2BF6K and a molecular weight of 187.92 g/mol. IUPAC name: potassium trifluoro(1,2,2-trifluoroethenyl)boranuide. InChIKey: UNTWUEFZFBFAAI-UHFFFAOYSA-N.
| Molecular formula | C2BF6K |
|---|---|
| Molecular weight | 187.92 g/mol |
| IUPAC name | potassium trifluoro(1,2,2-trifluoroethenyl)boranuide |
| InChIKey | UNTWUEFZFBFAAI-UHFFFAOYSA-N |
| SMILES | [B-](C(=C(F)F)F)(F)(F)F.[K+] |
Computed by PubChem (NCBI)