CAS 380344-35-4 appears in our catalog under these names: 4-(5-tert-Butyl-2,3-dimethyl-benzenesulfonylamino)-benzoic acid, 95%, 4-(5-tert-Butyl-2,3-dimethylbenzenesulfonamido)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-[(5-tert-butyl-2,3-dimethylphenyl)sulfonylamino]benzoic acid (CAS 380344-35-4) is a chemical compound with the molecular formula C19H23NO4S and a molecular weight of 361.5 g/mol. IUPAC name: 4-[(5-tert-butyl-2,3-dimethylphenyl)sulfonylamino]benzoic acid. InChIKey: OGLNQJYJSZKXKP-UHFFFAOYSA-N.
| Molecular formula | C19H23NO4S |
|---|---|
| Molecular weight | 361.5 g/mol |
| IUPAC name | 4-[(5-tert-butyl-2,3-dimethylphenyl)sulfonylamino]benzoic acid |
| InChIKey | OGLNQJYJSZKXKP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C)S(=O)(=O)NC2=CC=C(C=C2)C(=O)O)C(C)(C)C |
Computed by PubChem (NCBI)