CAS 380386-49-2 is the registry number for 3-(2-(Furan-2-ylmethylidene)hydrazin-1-yl)-6-(1H-imidazol-1-yl)pyridazine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
N-[(E)-furan-2-ylmethylideneamino]-6-imidazol-1-ylpyridazin-3-amine (CAS 380386-49-2) is a chemical compound with the molecular formula C12H10N6O and a molecular weight of 254.25 g/mol. IUPAC name: N-[(E)-furan-2-ylmethylideneamino]-6-imidazol-1-ylpyridazin-3-amine. InChIKey: PCKYIDZKMAVOEG-RIYZIHGNSA-N.
| Molecular formula | C12H10N6O |
|---|---|
| Molecular weight | 254.25 g/mol |
| IUPAC name | N-[(E)-furan-2-ylmethylideneamino]-6-imidazol-1-ylpyridazin-3-amine |
| InChIKey | PCKYIDZKMAVOEG-RIYZIHGNSA-N |
| SMILES | C1=COC(=C1)/C=N/NC2=NN=C(C=C2)N3C=CN=C3 |
Computed by PubChem (NCBI)