CAS 380431-13-0 appears in our catalog under these names: 5-(4-Phenoxy-phenylamino)-[1,3,4]thiadiazole-2-thiol, 95%, 5-((4-Phenoxyphenyl)amino)-1,3,4-thiadiazole-2-thiol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
5-(4-phenoxyanilino)-3H-1,3,4-thiadiazole-2-thione (CAS 380431-13-0) is a chemical compound with the molecular formula C14H11N3OS2 and a molecular weight of 301.4 g/mol. IUPAC name: 5-(4-phenoxyanilino)-3H-1,3,4-thiadiazole-2-thione. InChIKey: XJOJTXVYSRMVJY-UHFFFAOYSA-N.
| Molecular formula | C14H11N3OS2 |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | 5-(4-phenoxyanilino)-3H-1,3,4-thiadiazole-2-thione |
| InChIKey | XJOJTXVYSRMVJY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)NC3=NNC(=S)S3 |
Computed by PubChem (NCBI)