Products 380431-21-0

CAS 380431-21-0 appears in our catalog under these names: 5-Benzothiazol-2-yl-thiophene-2-carboxylic acid, 95%, 5-(1,3-Benzothiazol-2-yl)thiophene-2-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 0,5g.

Structural formula: {0} (CAS {1})

5-(1,3-benzothiazol-2-yl)thiophene-2-carboxylic acid (CAS 380431-21-0) is a chemical compound with the molecular formula C12H7NO2S2 and a molecular weight of 261.3 g/mol. IUPAC name: 5-(1,3-benzothiazol-2-yl)thiophene-2-carboxylic acid. InChIKey: GKBJZPGWTJQYCN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H7NO2S2
Molecular weight261.3 g/mol
IUPAC name5-(1,3-benzothiazol-2-yl)thiophene-2-carboxylic acid
InChIKeyGKBJZPGWTJQYCN-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)N=C(S2)C3=CC=C(S3)C(=O)O

Computed by PubChem (NCBI)