Products 380431-31-2
CAS 380431-31-2 is the registry number for 5-Amino-4-(1,3-benzothiazol-2-yl)-1-phenyl-2,3-dihydro-1H-pyrrol-2-one, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
(4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-phenylpyrrolidin-2-one (CAS 380431-31-2) is a chemical compound with the molecular formula C17H13N3OS and a molecular weight of 307.4 g/mol. IUPAC name: (4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-phenylpyrrolidin-2-one. InChIKey: PVRYMAVPSZZOHU-HLMYOLDLSA-N.
| Molecular formula | C17H13N3OS |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | (4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-phenylpyrrolidin-2-one |
| InChIKey | PVRYMAVPSZZOHU-HLMYOLDLSA-N |
| SMILES | C1/C(=C\2/NC3=CC=CC=C3S2)/C(=N)N(C1=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)