CAS 380453-90-7 appears in our catalog under these names: Methyl (3-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]thio)propanoate, 95%, Methyl 3-{(3-chloro-5-(trifluoromethyl)pyridin-2-yl)sulfanyl}propanoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Methyl 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanoate (CAS 380453-90-7) is a chemical compound with the molecular formula C10H9ClF3NO2S and a molecular weight of 299.70 g/mol. IUPAC name: methyl 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanoate. InChIKey: QEZCOVLYUYGUQL-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF3NO2S |
|---|---|
| Molecular weight | 299.70 g/mol |
| IUPAC name | methyl 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanoate |
| InChIKey | QEZCOVLYUYGUQL-UHFFFAOYSA-N |
| SMILES | COC(=O)CCSC1=C(C=C(C=N1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)