CAS 3805-37-6 is the registry number for Adenosine Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate (CAS 3805-37-6) is a chemical compound with the molecular formula C10H15N5O10P2 and a molecular weight of 427.20 g/mol. IUPAC name: [(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate. InChIKey: AEOBEOJCBAYXBA-KQYNXXCUSA-N.
| Molecular formula | C10H15N5O10P2 |
|---|---|
| Molecular weight | 427.20 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate |
| InChIKey | AEOBEOJCBAYXBA-KQYNXXCUSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)O)O)OP(=O)(O)O)N |
Computed by PubChem (NCBI)