CAS 380572-61-2 appears in our catalog under these names: 2-(({5,7-Dimethylimidazo(1,2-a)pyrimidin-2-yl}methyl)sulfanyl)propanoic acid, 2-(({5,7-dimethylimidazo(1,2-a)pyrimidin-2-yl}methyl)sulfanyl)propanoic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 5g.
2-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methylsulfanyl]propanoic acid (CAS 380572-61-2) is a chemical compound with the molecular formula C12H15N3O2S and a molecular weight of 265.33 g/mol. IUPAC name: 2-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methylsulfanyl]propanoic acid. InChIKey: HAKKMTBVANHGNK-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O2S |
|---|---|
| Molecular weight | 265.33 g/mol |
| IUPAC name | 2-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methylsulfanyl]propanoic acid |
| InChIKey | HAKKMTBVANHGNK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=NC(=CN12)CSC(C)C(=O)O)C |
Computed by PubChem (NCBI)