CAS 380626-56-2 is the registry number for 2,2''-Dibromo-5'-(2-bromophenyl)-1,1':3',1''-terphenyl, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
1,3,5-tris(2-bromophenyl)benzene (CAS 380626-56-2) is a chemical compound with the molecular formula C24H15Br3 and a molecular weight of 543.1 g/mol. IUPAC name: 1,3,5-tris(2-bromophenyl)benzene. InChIKey: CCCRAMFEOFEFKA-UHFFFAOYSA-N.
| Molecular formula | C24H15Br3 |
|---|---|
| Molecular weight | 543.1 g/mol |
| IUPAC name | 1,3,5-tris(2-bromophenyl)benzene |
| InChIKey | CCCRAMFEOFEFKA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CC(=C2)C3=CC=CC=C3Br)C4=CC=CC=C4Br)Br |
Computed by PubChem (NCBI)