CAS 3808-87-5 appears in our catalog under these names: Bis(2,4,5-trichlorophenyl) disulfide, 95%, Bis(2,4,5–trichlorophenyl) Disulfide, Bis(2,4,5-trichlorophenyl) Disulfide, Bis(2,4,5-trichlorophenyl) Disulfide, ≥95%(GC), ≥95%(GC), 1,2-Bis(2,4,5-trichlorophenyl)disulfide, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 10g.
1,2,4-trichloro-5-[(2,4,5-trichlorophenyl)disulfanyl]benzene (CAS 3808-87-5) is a chemical compound with the molecular formula C12H4Cl6S2 and a molecular weight of 425.0 g/mol. IUPAC name: 1,2,4-trichloro-5-[(2,4,5-trichlorophenyl)disulfanyl]benzene. InChIKey: ZUVJVEOHQKNMPN-UHFFFAOYSA-N.
| Molecular formula | C12H4Cl6S2 |
|---|---|
| Molecular weight | 425.0 g/mol |
| IUPAC name | 1,2,4-trichloro-5-[(2,4,5-trichlorophenyl)disulfanyl]benzene |
| InChIKey | ZUVJVEOHQKNMPN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)Cl)SSC2=CC(=C(C=C2Cl)Cl)Cl |
Computed by PubChem (NCBI)