CAS 380847-06-3 is the registry number for 1,4-bis(2-naphthylsulfonyl)-1,4-diazaperhydroepine. Offered by: Biosynth. Available pack sizes: 250mg.
1,4-bis(naphthalen-2-ylsulfonyl)-1,4-diazepane (CAS 380847-06-3) is a chemical compound with the molecular formula C25H24N2O4S2 and a molecular weight of 480.6 g/mol. IUPAC name: 1,4-bis(naphthalen-2-ylsulfonyl)-1,4-diazepane. InChIKey: MSIVJNAYNYSLBC-UHFFFAOYSA-N.
| Molecular formula | C25H24N2O4S2 |
|---|---|
| Molecular weight | 480.6 g/mol |
| IUPAC name | 1,4-bis(naphthalen-2-ylsulfonyl)-1,4-diazepane |
| InChIKey | MSIVJNAYNYSLBC-UHFFFAOYSA-N |
| SMILES | C1CN(CCN(C1)S(=O)(=O)C2=CC3=CC=CC=C3C=C2)S(=O)(=O)C4=CC5=CC=CC=C5C=C4 |
Computed by PubChem (NCBI)