Products 380873-23-4
CAS 380873-23-4 appears in our catalog under these names: 2-(4-Fluorophenyl)-8-methylimidazo[1,2-a]pyridine, 95+%, 95+%, 2-(4-Fluorophenyl)-8-methylimidazo[1,2-a]pyridine, 95+%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(4-fluorophenyl)-8-methylimidazo[1,2-a]pyridine (CAS 380873-23-4) is a chemical compound with the molecular formula C14H11FN2 and a molecular weight of 226.25 g/mol. IUPAC name: 2-(4-fluorophenyl)-8-methylimidazo[1,2-a]pyridine. InChIKey: UDBRHPCMIXCPEW-UHFFFAOYSA-N.
| Molecular formula | C14H11FN2 |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-8-methylimidazo[1,2-a]pyridine |
| InChIKey | UDBRHPCMIXCPEW-UHFFFAOYSA-N |
| SMILES | CC1=CC=CN2C1=NC(=C2)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)