CAS 380919-34-6 appears in our catalog under these names: Perampanel Impurity 3, Perampanel Impurity 11, Perampanel Impurity 21. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(2-oxo-1-phenyl-5-pyridin-2-yl-3-pyridinyl)benzamide (CAS 380919-34-6) is a chemical compound with the molecular formula C23H17N3O2 and a molecular weight of 367.4 g/mol. IUPAC name: 2-(2-oxo-1-phenyl-5-pyridin-2-yl-3-pyridinyl)benzamide. InChIKey: QWXWKENPMNTMCA-UHFFFAOYSA-N.
| Molecular formula | C23H17N3O2 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | 2-(2-oxo-1-phenyl-5-pyridin-2-yl-3-pyridinyl)benzamide |
| InChIKey | QWXWKENPMNTMCA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(C=C(C2=O)C3=CC=CC=C3C(=O)N)C4=CC=CC=N4 |
Computed by PubChem (NCBI)