CAS 3811-73-2 appears in our catalog under these names: 2-Mercaptopyridine N-Oxide Sodium Salt, 2–Mercaptopyridine N–oxide sodium salt, 2-Mercaptopyridine N-oxide sodium 96%, 2-MERCAPTOPYRIDINE N-OXIDE SODIUM SALT &, 2-Mercaptopyridine N-oxide, sodium salt,. Offered by: TRC, GLPBio, Ambeed, Sigma-Aldrich, MedChemExpress. Available pack sizes: 100g, 2,5g, 500g, 25g, 10G, 1G, 500ML, 5G.
Sodium 1-oxidopyridine-2-thione (CAS 3811-73-2) is a chemical compound with the molecular formula C5H4NNaOS and a molecular weight of 149.15 g/mol. IUPAC name: sodium 1-oxidopyridine-2-thione. InChIKey: XNRNJIIJLOFJEK-UHFFFAOYSA-N.
| Molecular formula | C5H4NNaOS |
|---|---|
| Molecular weight | 149.15 g/mol |
| IUPAC name | sodium 1-oxidopyridine-2-thione |
| InChIKey | XNRNJIIJLOFJEK-UHFFFAOYSA-N |
| SMILES | C1=CC(=S)N(C=C1)[O-].[Na+] |
Computed by PubChem (NCBI)