CAS 381178-19-4 is the registry number for 3-(4-Bromophenyl)-5-(2,4-dichlorophenyl)-1,2,4-oxadiazole, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(4-bromophenyl)-5-(2,4-dichlorophenyl)-1,2,4-oxadiazole (CAS 381178-19-4) is a chemical compound with the molecular formula C14H7BrCl2N2O and a molecular weight of 370.0 g/mol. IUPAC name: 3-(4-bromophenyl)-5-(2,4-dichlorophenyl)-1,2,4-oxadiazole. InChIKey: FCHAOUUZWMEJQJ-UHFFFAOYSA-N.
| Molecular formula | C14H7BrCl2N2O |
|---|---|
| Molecular weight | 370.0 g/mol |
| IUPAC name | 3-(4-bromophenyl)-5-(2,4-dichlorophenyl)-1,2,4-oxadiazole |
| InChIKey | FCHAOUUZWMEJQJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)C3=C(C=C(C=C3)Cl)Cl)Br |
Computed by PubChem (NCBI)