CAS 38135-31-8 is the registry number for Di-p-tert-Butylphenyl Phosphorochloridate. Offered by: TRC. Available pack sizes: 1g, 2,5g, 500mg.
1-tert-butyl-4-[(4-tert-butylphenoxy)-chlorophosphoryl]oxybenzene (CAS 38135-31-8) is a chemical compound with the molecular formula C20H26ClO3P and a molecular weight of 380.8 g/mol. IUPAC name: 1-tert-butyl-4-[(4-tert-butylphenoxy)-chlorophosphoryl]oxybenzene. InChIKey: PFWJBHJSKGMFNK-UHFFFAOYSA-N.
| Molecular formula | C20H26ClO3P |
|---|---|
| Molecular weight | 380.8 g/mol |
| IUPAC name | 1-tert-butyl-4-[(4-tert-butylphenoxy)-chlorophosphoryl]oxybenzene |
| InChIKey | PFWJBHJSKGMFNK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)OP(=O)(OC2=CC=C(C=C2)C(C)(C)C)Cl |
Computed by PubChem (NCBI)