CAS 381711-01-9 is the registry number for (3-(tert-Butyl)-2-hydroxyphenyl)diphenylphosphine oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-tert-butyl-6-diphenylphosphorylphenol (CAS 381711-01-9) is a chemical compound with the molecular formula C22H23O2P and a molecular weight of 350.4 g/mol. IUPAC name: 2-tert-butyl-6-diphenylphosphorylphenol. InChIKey: BTXKELCFYDPEEJ-UHFFFAOYSA-N.
| Molecular formula | C22H23O2P |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | 2-tert-butyl-6-diphenylphosphorylphenol |
| InChIKey | BTXKELCFYDPEEJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C(=CC=C1)P(=O)(C2=CC=CC=C2)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)