CAS 381731-49-3 appears in our catalog under these names: Ethyl 2-(3-(4-methylpiperidin-1-yl)propanamido)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate, 98%, 98%, Antiviral agent 30, Antiviral agent 30, 95.0%. Offered by: Chemat, GLPBio, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 5 mg, 10 mg.
Ethyl 2-[3-(4-methylpiperidin-1-yl)propanoylamino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (CAS 381731-49-3) is a chemical compound with the molecular formula C21H32N2O3S and a molecular weight of 392.6 g/mol. IUPAC name: ethyl 2-[3-(4-methylpiperidin-1-yl)propanoylamino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate. InChIKey: MYYREYNATUCYBC-UHFFFAOYSA-N.
| Molecular formula | C21H32N2O3S |
|---|---|
| Molecular weight | 392.6 g/mol |
| IUPAC name | ethyl 2-[3-(4-methylpiperidin-1-yl)propanoylamino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| InChIKey | MYYREYNATUCYBC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC2=C1CCCCC2)NC(=O)CCN3CCC(CC3)C |
Computed by PubChem (NCBI)