CAS 38178-99-3 is the registry number for 1,2,4,5,7,8-Hexachloro-9H-xanthene. Offered by: TRC. Available pack sizes: 25mg.
1,2,4,5,7,8-hexachloro-9H-xanthene (CAS 38178-99-3) is a chemical compound with the molecular formula C13H4Cl6O and a molecular weight of 388.9 g/mol. IUPAC name: 1,2,4,5,7,8-hexachloro-9H-xanthene. InChIKey: UJJKLXQRMWQYJE-UHFFFAOYSA-N.
| Molecular formula | C13H4Cl6O |
|---|---|
| Molecular weight | 388.9 g/mol |
| IUPAC name | 1,2,4,5,7,8-hexachloro-9H-xanthene |
| InChIKey | UJJKLXQRMWQYJE-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2Cl)Cl)Cl)OC3=C1C(=C(C=C3Cl)Cl)Cl |
Computed by PubChem (NCBI)