CAS 3819-09-8 is the registry number for Plastohydroquinone. Offered by: Chemat Brand. Available pack sizes: on request.
Plastoquinol-9 is a plastoquinol in which an all-E nonaprenyl group is attached to position 5 of 2,3-dimethylhydroquinone.
Source: ChEBI
| Molecular formula | C53H82O2 |
|---|---|
| Molecular weight | 751.2 g/mol |
| IUPAC name | 2,3-dimethyl-5-[(2E,6E,10E,14E,18E,22E,26E,30E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaenyl]benzene-1,4-diol |
| InChIKey | IJBLJLREWPLEPB-IQSNHBBHSA-N |
| SMILES | CC1=C(C=C(C(=C1C)O)C/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CCC=C(C)C)O |
Computed by PubChem (NCBI)