CAS 38192-13-1 is the registry number for 2-Chloro-N'-(2-chlorobenzoyl)benzohydrazide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-N'-(2-chlorobenzoyl)benzohydrazide (CAS 38192-13-1) is a chemical compound with the molecular formula C14H10Cl2N2O2 and a molecular weight of 309.1 g/mol. IUPAC name: 2-chloro-N'-(2-chlorobenzoyl)benzohydrazide. InChIKey: KDOJIUDRKBXHGD-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2N2O2 |
|---|---|
| Molecular weight | 309.1 g/mol |
| IUPAC name | 2-chloro-N'-(2-chlorobenzoyl)benzohydrazide |
| InChIKey | KDOJIUDRKBXHGD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NNC(=O)C2=CC=CC=C2Cl)Cl |
Computed by PubChem (NCBI)