CAS 382-28-5 appears in our catalog under these names: Perfluoro-N-methylmorpholine, >95% (GC), Perfluoro-N-Methylmorpholine. Offered by: TRC, Biosynth. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 50g.
2,2,3,3,5,5,6,6-octafluoro-4-(trifluoromethyl)morpholine (CAS 382-28-5) is a chemical compound with the molecular formula C5F11NO and a molecular weight of 299.04 g/mol. IUPAC name: 2,2,3,3,5,5,6,6-octafluoro-4-(trifluoromethyl)morpholine. InChIKey: PQMAKJUXOOVROI-UHFFFAOYSA-N.
| Molecular formula | C5F11NO |
|---|---|
| Molecular weight | 299.04 g/mol |
| IUPAC name | 2,2,3,3,5,5,6,6-octafluoro-4-(trifluoromethyl)morpholine |
| InChIKey | PQMAKJUXOOVROI-UHFFFAOYSA-N |
| SMILES | C1(C(OC(C(N1C(F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)