CAS 382-40-1 is the registry number for Ethyl trifluoroacetyldibromoacetate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 1g.
Ethyl 2,2-dibromo-4,4,4-trifluoro-3-oxobutanoate (CAS 382-40-1) is a chemical compound with the molecular formula C6H5Br2F3O3 and a molecular weight of 341.90 g/mol. IUPAC name: ethyl 2,2-dibromo-4,4,4-trifluoro-3-oxobutanoate. InChIKey: LMCIVMXOGHQNTR-UHFFFAOYSA-N.
| Molecular formula | C6H5Br2F3O3 |
|---|---|
| Molecular weight | 341.90 g/mol |
| IUPAC name | ethyl 2,2-dibromo-4,4,4-trifluoro-3-oxobutanoate |
| InChIKey | LMCIVMXOGHQNTR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)C(F)(F)F)(Br)Br |
Computed by PubChem (NCBI)