CAS 38207-37-3 appears in our catalog under these names: 3-cis-Hydroxyglipizide, Glipizide Impurity 25, Glipizide impurity 5. Offered by: TRC, Chemat Brand, MedChemExpress. Available pack sizes: 50mg, on request, Get quote.
N-[2-[4-[[(1R,3S)-3-hydroxycyclohexyl]carbamoylsulfamoyl]phenyl]ethyl]-5-methylpyrazine-2-carboxamide (CAS 38207-37-3) is a chemical compound with the molecular formula C21H27N5O5S and a molecular weight of 461.5 g/mol. IUPAC name: N-[2-[4-[[(1R,3S)-3-hydroxycyclohexyl]carbamoylsulfamoyl]phenyl]ethyl]-5-methylpyrazine-2-carboxamide. InChIKey: GZLIUWBDTXQVBY-SJORKVTESA-N.
| Molecular formula | C21H27N5O5S |
|---|---|
| Molecular weight | 461.5 g/mol |
| IUPAC name | N-[2-[4-[[(1R,3S)-3-hydroxycyclohexyl]carbamoylsulfamoyl]phenyl]ethyl]-5-methylpyrazine-2-carboxamide |
| InChIKey | GZLIUWBDTXQVBY-SJORKVTESA-N |
| SMILES | CC1=CN=C(C=N1)C(=O)NCCC2=CC=C(C=C2)S(=O)(=O)NC(=O)N[C@@H]3CCC[C@@H](C3)O |
Computed by PubChem (NCBI)