CAS 382162-12-1 appears in our catalog under these names: Phthalimide–PEG3–C2–OTs, 2-(2-(2-(2-(1,3-Dioxoisoindolin-2-yl)ethoxy)ethoxy)ethoxy)ethyl 4-methylbenzenesulfonate, 95%, 95%, Phthalimide-PEG3-C2-OTs, Phthalimide-PEG3-C2-OTs, 95%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 25 mg, 100 mg, 1 g, 250 mg, 50 mg.
2-[2-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 382162-12-1) is a chemical compound with the molecular formula C23H27NO8S and a molecular weight of 477.5 g/mol. IUPAC name: 2-[2-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: LWPAUABODZZAIN-UHFFFAOYSA-N.
| Molecular formula | C23H27NO8S |
|---|---|
| Molecular weight | 477.5 g/mol |
| IUPAC name | 2-[2-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | LWPAUABODZZAIN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCN2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)