CAS 3824-97-3 is the registry number for 1,2,3-Trichloropentafluorocyclopentene-1, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
1,2,3-trichloro-3,4,4,5,5-pentafluorocyclopentene (CAS 3824-97-3) is a chemical compound with the molecular formula C5Cl3F5 and a molecular weight of 261.40 g/mol. IUPAC name: 1,2,3-trichloro-3,4,4,5,5-pentafluorocyclopentene. InChIKey: JMTPGSMYAMXWBK-UHFFFAOYSA-N.
| Molecular formula | C5Cl3F5 |
|---|---|
| Molecular weight | 261.40 g/mol |
| IUPAC name | 1,2,3-trichloro-3,4,4,5,5-pentafluorocyclopentene |
| InChIKey | JMTPGSMYAMXWBK-UHFFFAOYSA-N |
| SMILES | C1(=C(C(C(C1(F)F)(F)F)(F)Cl)Cl)Cl |
Computed by PubChem (NCBI)