CAS 3825-26-1 appears in our catalog under these names: Pentadecafluorooctanoic Acid Ammonium Salt, >95% (HPLC), Perfluorooctanoic acid ammonium, Perfluorooctanoic acid ammonium 100 µg/mL in Methanol, pentadecafluorooctanoic acid ammonium salt, PENTADECAFLUOROOCTANOIC ACID AMMONIUM S&. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Sigma-Aldrich, Roth. Available pack sizes: 1g, 2,5g, 5g, 100mg, 1ml, 25g, 10G, 50G.
Azanium 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate (CAS 3825-26-1) is a chemical compound with the molecular formula C8H4F15NO2 and a molecular weight of 431.10 g/mol. IUPAC name: azanium 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate. InChIKey: YOALFLHFSFEMLP-UHFFFAOYSA-N.
| Molecular formula | C8H4F15NO2 |
|---|---|
| Molecular weight | 431.10 g/mol |
| IUPAC name | azanium 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate |
| InChIKey | YOALFLHFSFEMLP-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)[O-].[NH4+] |
Computed by PubChem (NCBI)