CAS 38254-66-9 appears in our catalog under these names: (2R,2'R)-3,3'-Disulfanediylbis(2-(dimethylamino)propanoic acid), 95%, N,N,N’,N’-Tetramethyl-L-cystine Dihydrochloride, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(2R)-3-[[(2R)-2-carboxy-2-(dimethylamino)ethyl]disulfanyl]-2-(dimethylamino)propanoic acid (CAS 38254-66-9) is a chemical compound with the molecular formula C10H20N2O4S2 and a molecular weight of 296.4 g/mol. IUPAC name: (2R)-3-[[(2R)-2-carboxy-2-(dimethylamino)ethyl]disulfanyl]-2-(dimethylamino)propanoic acid. InChIKey: RICIRHDRDJOBID-YUMQZZPRSA-N.
| Molecular formula | C10H20N2O4S2 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | (2R)-3-[[(2R)-2-carboxy-2-(dimethylamino)ethyl]disulfanyl]-2-(dimethylamino)propanoic acid |
| InChIKey | RICIRHDRDJOBID-YUMQZZPRSA-N |
| SMILES | CN(C)[C@@H](CSSC[C@@H](C(=O)O)N(C)C)C(=O)O |
Computed by PubChem (NCBI)