CAS 383136-18-3 is the registry number for 1-(3-Chloro-4-fluoro-phenyl)pyrrole-2-carbaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-chloro-4-fluorophenyl)pyrrole-2-carbaldehyde (CAS 383136-18-3) is a chemical compound with the molecular formula C11H7ClFNO and a molecular weight of 223.63 g/mol. IUPAC name: 1-(3-chloro-4-fluorophenyl)pyrrole-2-carbaldehyde. InChIKey: WNJULMDHYCFWDG-UHFFFAOYSA-N.
| Molecular formula | C11H7ClFNO |
|---|---|
| Molecular weight | 223.63 g/mol |
| IUPAC name | 1-(3-chloro-4-fluorophenyl)pyrrole-2-carbaldehyde |
| InChIKey | WNJULMDHYCFWDG-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=C1)C=O)C2=CC(=C(C=C2)F)Cl |
Computed by PubChem (NCBI)