CAS 383143-05-3 appears in our catalog under these names: 4-(2,5-Dichlorophenyl)-1,3-thiazole-2-carbaldehyde, 95%, 4-(2,5-Dichlorophenyl)-1,3-thiazole-2-carbaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-(2,5-dichlorophenyl)-1,3-thiazole-2-carbaldehyde (CAS 383143-05-3) is a chemical compound with the molecular formula C10H5Cl2NOS and a molecular weight of 258.12 g/mol. IUPAC name: 4-(2,5-dichlorophenyl)-1,3-thiazole-2-carbaldehyde. InChIKey: UILXHAOEWSAUCD-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NOS |
|---|---|
| Molecular weight | 258.12 g/mol |
| IUPAC name | 4-(2,5-dichlorophenyl)-1,3-thiazole-2-carbaldehyde |
| InChIKey | UILXHAOEWSAUCD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C2=CSC(=N2)C=O)Cl |
Computed by PubChem (NCBI)