Products 383148-06-9

CAS 383148-06-9 is the registry number for 2,3-Dimethyl-6-(4-methyl-1-piperazinyl)quinoxaline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

2,3-dimethyl-6-(4-methylpiperazin-1-yl)quinoxaline (CAS 383148-06-9) is a chemical compound with the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. IUPAC name: 2,3-dimethyl-6-(4-methylpiperazin-1-yl)quinoxaline. InChIKey: MWOMRYHUSQVCNX-UHFFFAOYSA-N.

Identity
Molecular formulaC15H20N4
Molecular weight256.35 g/mol
IUPAC name2,3-dimethyl-6-(4-methylpiperazin-1-yl)quinoxaline
InChIKeyMWOMRYHUSQVCNX-UHFFFAOYSA-N
SMILESCC1=C(N=C2C=C(C=CC2=N1)N3CCN(CC3)C)C

Computed by PubChem (NCBI)