CAS 3832-15-3 is the registry number for Trans-1,2-dichlorohexafluorocyclobutane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Trans-(1S,2S)-1,2-dichloro-1,2,3,3,4,4-hexafluorocyclobutane (CAS 3832-15-3) is a chemical compound with the molecular formula C4Cl2F6 and a molecular weight of 232.94 g/mol. IUPAC name: trans-(1S,2S)-1,2-dichloro-1,2,3,3,4,4-hexafluorocyclobutane. InChIKey: LMHAGAHDHRQIMB-LWMBPPNESA-N.
| Molecular formula | C4Cl2F6 |
|---|---|
| Molecular weight | 232.94 g/mol |
| IUPAC name | trans-(1S,2S)-1,2-dichloro-1,2,3,3,4,4-hexafluorocyclobutane |
| InChIKey | LMHAGAHDHRQIMB-LWMBPPNESA-N |
| SMILES | [C@]1([C@@](C(C1(F)F)(F)F)(F)Cl)(F)Cl |
Computed by PubChem (NCBI)