CAS 3832-65-3 is the registry number for 1,4-Bis(1,1,2,2-tetrafluoroethoxy)benzene, 97%. Offered by: Fluorochem. Available pack sizes: 1g, 10g.
1,4-bis(1,1,2,2-tetrafluoroethoxy)benzene (CAS 3832-65-3) is a chemical compound with the molecular formula C10H6F8O2 and a molecular weight of 310.14 g/mol. IUPAC name: 1,4-bis(1,1,2,2-tetrafluoroethoxy)benzene. InChIKey: SYMFAUQESLPCRO-UHFFFAOYSA-N.
| Molecular formula | C10H6F8O2 |
|---|---|
| Molecular weight | 310.14 g/mol |
| IUPAC name | 1,4-bis(1,1,2,2-tetrafluoroethoxy)benzene |
| InChIKey | SYMFAUQESLPCRO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC(C(F)F)(F)F)OC(C(F)F)(F)F |
Computed by PubChem (NCBI)