CAS 38332-12-6 is the registry number for rel–(1R,2R,3S)–2–aminocyclohexane–1,3–diol. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
Cis-(1S,3R)-2-aminocyclohexane-1,3-diol (CAS 38332-12-6) is a chemical compound with the molecular formula C6H13NO2 and a molecular weight of 131.17 g/mol. IUPAC name: cis-(1S,3R)-2-aminocyclohexane-1,3-diol. InChIKey: MNLZNJPXUJURMD-XEAPYIEGSA-N.
| Molecular formula | C6H13NO2 |
|---|---|
| Molecular weight | 131.17 g/mol |
| IUPAC name | cis-(1S,3R)-2-aminocyclohexane-1,3-diol |
| InChIKey | MNLZNJPXUJURMD-XEAPYIEGSA-N |
| SMILES | C1C[C@H](C([C@H](C1)O)N)O |
Computed by PubChem (NCBI)