CAS 38334-85-9 is the registry number for 7,7-Dichlorospiro[bicyclo[4.1.0]heptane-3,2'-[1,3]dioxolane], 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7',7'-dichlorospiro[1,3-dioxolane-2,3'-bicyclo[4.1.0]heptane] (CAS 38334-85-9) is a chemical compound with the molecular formula C9H12Cl2O2 and a molecular weight of 223.09 g/mol. IUPAC name: 7',7'-dichlorospiro[1,3-dioxolane-2,3'-bicyclo[4.1.0]heptane]. InChIKey: DPSUJCHTHHBNNH-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2O2 |
|---|---|
| Molecular weight | 223.09 g/mol |
| IUPAC name | 7',7'-dichlorospiro[1,3-dioxolane-2,3'-bicyclo[4.1.0]heptane] |
| InChIKey | DPSUJCHTHHBNNH-UHFFFAOYSA-N |
| SMILES | C1CC2(CC3C1C3(Cl)Cl)OCCO2 |
Computed by PubChem (NCBI)