Products 38377-59-2
CAS 38377-59-2 is the registry number for 2-(3-Methylphenyl)-3-oxobutanenitrile. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(3-methylphenyl)-3-oxobutanenitrile (CAS 38377-59-2) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 2-(3-methylphenyl)-3-oxobutanenitrile. InChIKey: VTMXXWNCTGJYOY-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 2-(3-methylphenyl)-3-oxobutanenitrile |
| InChIKey | VTMXXWNCTGJYOY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(C#N)C(=O)C |
Computed by PubChem (NCBI)