CAS 384-87-2 is the registry number for 2,4,6-Tribromo-3-(trifluoromethyl)phenol, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
2,4,6-tribromo-3-(trifluoromethyl)phenol (CAS 384-87-2) is a chemical compound with the molecular formula C7H2Br3F3O and a molecular weight of 398.80 g/mol. IUPAC name: 2,4,6-tribromo-3-(trifluoromethyl)phenol. InChIKey: UJGDTIJKYXZZNR-UHFFFAOYSA-N.
| Molecular formula | C7H2Br3F3O |
|---|---|
| Molecular weight | 398.80 g/mol |
| IUPAC name | 2,4,6-tribromo-3-(trifluoromethyl)phenol |
| InChIKey | UJGDTIJKYXZZNR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)O)Br)C(F)(F)F)Br |
Computed by PubChem (NCBI)